C10H9NO2S — CID 94044870
5-[[(2R)-oxiran-2-yl]methoxy]-1,3-benzothiazole (PubChem CID 94044870) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is 5-[[(2R)-oxiran-2-yl]methoxy]-1,3-benzothiazole.
| Compound Name | 5-[[(2R)-oxiran-2-yl]methoxy]-1,3-benzothiazole |
|---|---|
| PubChem CID | 94044870 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 5-[[(2R)-oxiran-2-yl]methoxy]-1,3-benzothiazole |
| SMILES | c1nc2cc(OC[C@H]3CO3)ccc2s1 |
| InChI | InChI=1S/C10H9NO2S/c1-2-10-9(11-6-14-10)3-7(1)12-4-8-5-13-8/h1-3,6,8H,4-5H2/t8-/m0/s1 |
| InChIKey | ATVXMTAUFAKSFA-QMMMGPOBSA-N |
| XLogP | 2.07 |
| TPSA | 34.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|