C14H16F3N3O3 — CID 94066273
(3S)-1-acetyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-3-carboxamide (PubChem CID 94066273) has the molecular formula C14H16F3N3O3 and a molecular weight of 331.29 g/mol. Its IUPAC name is (3S)-1-acetyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-acetyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94066273 |
| Molecular Formula | C14H16F3N3O3 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (3S)-1-acetyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-3-carboxamide |
| SMILES | CC(=O)N1CCC[C@H](C(=O)Nc2cc(C(F)(F)F)c[nH]c2=O)C1 |
| InChI | InChI=1S/C14H16F3N3O3/c1-8(21)20-4-2-3-9(7-20)12(22)19-11-5-10(14(15,16)17)6-18-13(11)23/h5-6,9H,2-4,7H2,1H3,(H,18,23)(H,19,22)/t9-/m0/s1 |
| InChIKey | FAPWVYKTIPGCNS-VIFPVBQESA-N |
| XLogP | 1.59 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |