About (3S)-1-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride
(3S)-1-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride (PubChem CID 94068530) has the molecular formula C20H16Cl2N2O3
and a molecular weight of 403.27 g/mol. Its IUPAC name is (3S)-1-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride.
Molecular Properties
| Compound Name | (3S)-1-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride |
| PubChem CID | 94068530 |
| Molecular Formula | C20H16Cl2N2O3 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | (3S)-1-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride |
| SMILES | Cc1cc(C)c2oc(-c3cc(N4C[C@@H](C(=O)Cl)CC4=O)ccc3Cl)nc2c1 |
| InChI | InChI=1S/C20H16Cl2N2O3/c1-10-5-11(2)18-16(6-10)23-20(27-18)14-8-13(3-4-15(14)21)24-9-12(19(22)26)7-17(24)25/h3-6,8,12H,7,9H2,1-2H3/t12-/m0/s1 |
| InChIKey | RIFFUWPLXBQRIZ-LBPRGKRZSA-N |
| XLogP | 4.88 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride?
The IUPAC name of (3S)-1-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride (CID 94068530) is (3S)-1-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride.
What is the SMILES notation for (3S)-1-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride?
The canonical SMILES for (3S)-1-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride is Cc1cc(C)c2oc(-c3cc(N4C[C@@H](C(=O)Cl)CC4=O)ccc3Cl)nc2c1.
What is the InChIKey of (3S)-1-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride?
The InChIKey is RIFFUWPLXBQRIZ-LBPRGKRZSA-N. The full InChI is InChI=1S/C20H16Cl2N2O3/c1-10-5-11(2)18-16(6-10)23-20(27-18)14-8-13(3-4-15(14)21)24-9-12(19(22)26)7-17(24)25/h3-6,8,12H,7,9H2,1-2H3/t12-/m0/s1.
What are the key properties of (3S)-1-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride?
(3S)-1-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride has a molecular weight of 403.27 g/mol, XLogP of 4.88, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride is sourced from PubChem (CID 94068530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).