C20H23NO3 — CID 940871
[(4S)-2,2,4-trimethyl-3,4-dihydro-1H-quinolin-6-yl] 2-methoxybenzoate (PubChem CID 940871) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is [(4S)-2,2,4-trimethyl-3,4-dihydro-1H-quinolin-6-yl] 2-methoxybenzoate.
| Compound Name | [(4S)-2,2,4-trimethyl-3,4-dihydro-1H-quinolin-6-yl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 940871 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | [(4S)-2,2,4-trimethyl-3,4-dihydro-1H-quinolin-6-yl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)Oc1ccc2c(c1)[C@@H](C)CC(C)(C)N2 |
| InChI | InChI=1S/C20H23NO3/c1-13-12-20(2,3)21-17-10-9-14(11-16(13)17)24-19(22)15-7-5-6-8-18(15)23-4/h5-11,13,21H,12H2,1-4H3/t13-/m0/s1 |
| InChIKey | NSUHOGVXTFHISN-ZDUSSCGKSA-N |
| XLogP | 4.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|