C18H19N3S — CID 943241
(3S)-N-(2-ethylphenyl)-3-phenyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 943241) has the molecular formula C18H19N3S and a molecular weight of 309.44 g/mol. Its IUPAC name is (3S)-N-(2-ethylphenyl)-3-phenyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | (3S)-N-(2-ethylphenyl)-3-phenyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 943241 |
| Molecular Formula | C18H19N3S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (3S)-N-(2-ethylphenyl)-3-phenyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | CCc1ccccc1NC(=S)N1N=CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H19N3S/c1-2-14-8-6-7-11-16(14)20-18(22)21-17(12-13-19-21)15-9-4-3-5-10-15/h3-11,13,17H,2,12H2,1H3,(H,20,22)/t17-/m0/s1 |
| InChIKey | TVFBYQKJTSMSMY-KRWDZBQOSA-N |
| XLogP | 4.38 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|