C15H22ClN3OS — CID 94442915
1-[(5-chlorothiophen-2-yl)methyl]-3-[(3S)-1-methylpiperidin-3-yl]-1-prop-2-enylurea (PubChem CID 94442915) has the molecular formula C15H22ClN3OS and a molecular weight of 327.88 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-3-[(3S)-1-methylpiperidin-3-yl]-1-prop-2-enylurea.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-[(3S)-1-methylpiperidin-3-yl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 94442915 |
| Molecular Formula | C15H22ClN3OS |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-[(3S)-1-methylpiperidin-3-yl]-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)N[C@H]1CCCN(C)C1 |
| InChI | InChI=1S/C15H22ClN3OS/c1-3-8-19(11-13-6-7-14(16)21-13)15(20)17-12-5-4-9-18(2)10-12/h3,6-7,12H,1,4-5,8-11H2,2H3,(H,17,20)/t12-/m0/s1 |
| InChIKey | JCEZBAANQMIDED-LBPRGKRZSA-N |
| XLogP | 3.19 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|