C18H21FN2O4 — CID 94458056
N-[(2R)-1-[3-(4-fluorophenoxy)propyl-methylamino]-1-oxopropan-2-yl]furan-3-carboxamide (PubChem CID 94458056) has the molecular formula C18H21FN2O4 and a molecular weight of 348.37 g/mol. Its IUPAC name is N-[(2R)-1-[3-(4-fluorophenoxy)propyl-methylamino]-1-oxopropan-2-yl]furan-3-carboxamide.
| Compound Name | N-[(2R)-1-[3-(4-fluorophenoxy)propyl-methylamino]-1-oxopropan-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 94458056 |
| Molecular Formula | C18H21FN2O4 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-[(2R)-1-[3-(4-fluorophenoxy)propyl-methylamino]-1-oxopropan-2-yl]furan-3-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccoc1)C(=O)N(C)CCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C18H21FN2O4/c1-13(20-17(22)14-8-11-24-12-14)18(23)21(2)9-3-10-25-16-6-4-15(19)5-7-16/h4-8,11-13H,3,9-10H2,1-2H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | VOPPIKCBMCKHTH-CYBMUJFWSA-N |
| XLogP | 2.46 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|