C23H19NO4S — CID 9448952
(E)-2-benzoyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(3-methylthiophen-2-yl)prop-2-enamide (PubChem CID 9448952) has the molecular formula C23H19NO4S and a molecular weight of 405.48 g/mol. Its IUPAC name is (E)-2-benzoyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(3-methylthiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-2-benzoyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(3-methylthiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9448952 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (E)-2-benzoyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(3-methylthiophen-2-yl)prop-2-enamide |
| SMILES | Cc1ccsc1/C=C(/C(=O)Nc1ccc2c(c1)OCCO2)C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19NO4S/c1-15-9-12-29-21(15)14-18(22(25)16-5-3-2-4-6-16)23(26)24-17-7-8-19-20(13-17)28-11-10-27-19/h2-9,12-14H,10-11H2,1H3,(H,24,26)/b18-14+ |
| InChIKey | NUZPUKIJPYGMOE-NBVRZTHBSA-N |
| XLogP | 4.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|