C22H22ClN3O3 — CID 9459242
(2-chloroquinolin-3-yl)methyl (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate (PubChem CID 9459242) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is (2-chloroquinolin-3-yl)methyl (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate.
| Compound Name | (2-chloroquinolin-3-yl)methyl (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 9459242 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (2-chloroquinolin-3-yl)methyl (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
| SMILES | CC(C)[C@H](NC(=O)Nc1ccccc1)C(=O)OCc1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C22H22ClN3O3/c1-14(2)19(26-22(28)24-17-9-4-3-5-10-17)21(27)29-13-16-12-15-8-6-7-11-18(15)25-20(16)23/h3-12,14,19H,13H2,1-2H3,(H2,24,26,28)/t19-/m0/s1 |
| InChIKey | RDKXBQSQLPITIQ-IBGZPJMESA-N |
| XLogP | 4.78 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|