C13H11N4O4S- — CID 9463629
4-[(Z)-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]hydrazinylidene]methyl]-2-nitrophenolate (PubChem CID 9463629) has the molecular formula C13H11N4O4S- and a molecular weight of 319.32 g/mol. Its IUPAC name is 4-[(Z)-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]hydrazinylidene]methyl]-2-nitrophenolate.
| Compound Name | 4-[(Z)-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]hydrazinylidene]methyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 9463629 |
| Molecular Formula | C13H11N4O4S- |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 4-[(Z)-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]hydrazinylidene]methyl]-2-nitrophenolate |
| SMILES | Cc1nc(CC(=O)N/N=C\c2ccc([O-])c([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C13H12N4O4S/c1-8-15-10(7-22-8)5-13(19)16-14-6-9-2-3-12(18)11(4-9)17(20)21/h2-4,6-7,18H,5H2,1H3,(H,16,19)/p-1/b14-6- |
| InChIKey | PHNAWFUDYZUNIN-NSIKDUERSA-M |
| XLogP | 1.13 |
| TPSA | 120.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|