C21H19N3O4S — CID 9471385
N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-(6-ethyl-1-benzofuran-3-yl)acetohydrazide (PubChem CID 9471385) has the molecular formula C21H19N3O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-(6-ethyl-1-benzofuran-3-yl)acetohydrazide.
| Compound Name | N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-(6-ethyl-1-benzofuran-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 9471385 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-(6-ethyl-1-benzofuran-3-yl)acetohydrazide |
| SMILES | CCc1ccc2c(CC(=O)NNC(=O)CSc3nc4ccccc4o3)coc2c1 |
| InChI | InChI=1S/C21H19N3O4S/c1-2-13-7-8-15-14(11-27-18(15)9-13)10-19(25)23-24-20(26)12-29-21-22-16-5-3-4-6-17(16)28-21/h3-9,11H,2,10,12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | CMQAYZIZOXBNCN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|