About methyl 1-[(1R,2S)-2-(1-methylpyrazole-4-carbonyl)oxycyclohexyl]triazole-4-carboxylate
methyl 1-[(1R,2S)-2-(1-methylpyrazole-4-carbonyl)oxycyclohexyl]triazole-4-carboxylate (PubChem CID 94809463) has the molecular formula C15H19N5O4
and a molecular weight of 333.35 g/mol. Its IUPAC name is methyl 1-[(1R,2S)-2-(1-methylpyrazole-4-carbonyl)oxycyclohexyl]triazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(1R,2S)-2-(1-methylpyrazole-4-carbonyl)oxycyclohexyl]triazole-4-carboxylate |
| PubChem CID | 94809463 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | methyl 1-[(1R,2S)-2-(1-methylpyrazole-4-carbonyl)oxycyclohexyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn([C@@H]2CCCC[C@@H]2OC(=O)c2cnn(C)c2)nn1 |
| InChI | InChI=1S/C15H19N5O4/c1-19-8-10(7-16-19)14(21)24-13-6-4-3-5-12(13)20-9-11(17-18-20)15(22)23-2/h7-9,12-13H,3-6H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | FLHVKGHIHXHILI-OLZOCXBDSA-N |
| XLogP | 1.14 |
| TPSA | 101.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze methyl 1-[(1R,2S)-2-(1-methylpyrazole-4-carbonyl)oxycyclohexyl]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(1R,2S)-2-(1-methylpyrazole-4-carbonyl)oxycyclohexyl]triazole-4-carboxylate?
The IUPAC name of methyl 1-[(1R,2S)-2-(1-methylpyrazole-4-carbonyl)oxycyclohexyl]triazole-4-carboxylate (CID 94809463) is methyl 1-[(1R,2S)-2-(1-methylpyrazole-4-carbonyl)oxycyclohexyl]triazole-4-carboxylate.
What is the SMILES notation for methyl 1-[(1R,2S)-2-(1-methylpyrazole-4-carbonyl)oxycyclohexyl]triazole-4-carboxylate?
The canonical SMILES for methyl 1-[(1R,2S)-2-(1-methylpyrazole-4-carbonyl)oxycyclohexyl]triazole-4-carboxylate is COC(=O)c1cn([C@@H]2CCCC[C@@H]2OC(=O)c2cnn(C)c2)nn1.
What is the InChIKey of methyl 1-[(1R,2S)-2-(1-methylpyrazole-4-carbonyl)oxycyclohexyl]triazole-4-carboxylate?
The InChIKey is FLHVKGHIHXHILI-OLZOCXBDSA-N. The full InChI is InChI=1S/C15H19N5O4/c1-19-8-10(7-16-19)14(21)24-13-6-4-3-5-12(13)20-9-11(17-18-20)15(22)23-2/h7-9,12-13H,3-6H2,1-2H3/t12-,13+/m1/s1.
What are the key properties of methyl 1-[(1R,2S)-2-(1-methylpyrazole-4-carbonyl)oxycyclohexyl]triazole-4-carboxylate?
methyl 1-[(1R,2S)-2-(1-methylpyrazole-4-carbonyl)oxycyclohexyl]triazole-4-carboxylate has a molecular weight of 333.35 g/mol, XLogP of 1.14, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(1R,2S)-2-(1-methylpyrazole-4-carbonyl)oxycyclohexyl]triazole-4-carboxylate is sourced from PubChem (CID 94809463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).