C23H23N3O4 — CID 76870411
methyl 1-[2-(3-naphthalen-1-ylprop-2-enoyloxy)cyclohexyl]triazole-4-carboxylate (PubChem CID 76870411) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is methyl 1-[2-(3-naphthalen-1-ylprop-2-enoyloxy)cyclohexyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[2-(3-naphthalen-1-ylprop-2-enoyloxy)cyclohexyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 76870411 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | methyl 1-[2-(3-naphthalen-1-ylprop-2-enoyloxy)cyclohexyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(C2CCCCC2OC(=O)C=Cc2cccc3ccccc23)nn1 |
| InChI | InChI=1S/C23H23N3O4/c1-29-23(28)19-15-26(25-24-19)20-11-4-5-12-21(20)30-22(27)14-13-17-9-6-8-16-7-2-3-10-18(16)17/h2-3,6-10,13-15,20-21H,4-5,11-12H2,1H3 |
| InChIKey | DZWXDHVZWOEQHA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|