C19H21N3O4 — CID 75268947
methyl 1-[2-(3-phenylprop-2-enoyloxy)cyclohexyl]triazole-4-carboxylate (PubChem CID 75268947) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is methyl 1-[2-(3-phenylprop-2-enoyloxy)cyclohexyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[2-(3-phenylprop-2-enoyloxy)cyclohexyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 75268947 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | methyl 1-[2-(3-phenylprop-2-enoyloxy)cyclohexyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(C2CCCCC2OC(=O)C=Cc2ccccc2)nn1 |
| InChI | InChI=1S/C19H21N3O4/c1-25-19(24)15-13-22(21-20-15)16-9-5-6-10-17(16)26-18(23)12-11-14-7-3-2-4-8-14/h2-4,7-8,11-13,16-17H,5-6,9-10H2,1H3 |
| InChIKey | VQHKJZBGSYOTQA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|