C18H17F2N3O2 — CID 94819784
1-(3-cyanophenyl)-3-[(2R,3S)-4,4-difluoro-3-hydroxy-1-phenylbutan-2-yl]urea (PubChem CID 94819784) has the molecular formula C18H17F2N3O2 and a molecular weight of 345.35 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[(2R,3S)-4,4-difluoro-3-hydroxy-1-phenylbutan-2-yl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[(2R,3S)-4,4-difluoro-3-hydroxy-1-phenylbutan-2-yl]urea |
|---|---|
| PubChem CID | 94819784 |
| Molecular Formula | C18H17F2N3O2 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[(2R,3S)-4,4-difluoro-3-hydroxy-1-phenylbutan-2-yl]urea |
| SMILES | N#Cc1cccc(NC(=O)N[C@H](Cc2ccccc2)[C@H](O)C(F)F)c1 |
| InChI | InChI=1S/C18H17F2N3O2/c19-17(20)16(24)15(10-12-5-2-1-3-6-12)23-18(25)22-14-8-4-7-13(9-14)11-21/h1-9,15-17,24H,10H2,(H2,22,23,25)/t15-,16+/m1/s1 |
| InChIKey | GEVLYMZRCLLZJF-CVEARBPZSA-N |
| XLogP | 2.92 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |