About 6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide
6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide (PubChem CID 94963662) has the molecular formula C9H14N4O6S
and a molecular weight of 306.30 g/mol. Its IUPAC name is 6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide |
| PubChem CID | 94963662 |
| Molecular Formula | C9H14N4O6S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide |
| SMILES | COC(CNS(=O)(=O)c1cnc(N)c([N+](=O)[O-])c1)OC |
| InChI | InChI=1S/C9H14N4O6S/c1-18-8(19-2)5-12-20(16,17)6-3-7(13(14)15)9(10)11-4-6/h3-4,8,12H,5H2,1-2H3,(H2,10,11) |
| InChIKey | WTIOMQSNIRDFJA-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide?
The IUPAC name of 6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide (CID 94963662) is 6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide.
What is the SMILES notation for 6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide?
The canonical SMILES for 6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide is COC(CNS(=O)(=O)c1cnc(N)c([N+](=O)[O-])c1)OC.
What is the InChIKey of 6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide?
The InChIKey is WTIOMQSNIRDFJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O6S/c1-18-8(19-2)5-12-20(16,17)6-3-7(13(14)15)9(10)11-4-6/h3-4,8,12H,5H2,1-2H3,(H2,10,11).
What are the key properties of 6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide?
6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide has a molecular weight of 306.30 g/mol, XLogP of -0.53, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide is sourced from PubChem (CID 94963662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).