C9H14N4O6S — CID 94963662
6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide (PubChem CID 94963662) has the molecular formula C9H14N4O6S and a molecular weight of 306.30 g/mol. Its IUPAC name is 6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide.
| Compound Name | 6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 94963662 |
| Molecular Formula | C9H14N4O6S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 6-amino-N-(2,2-dimethoxyethyl)-5-nitropyridine-3-sulfonamide |
| SMILES | COC(CNS(=O)(=O)c1cnc(N)c([N+](=O)[O-])c1)OC |
| InChI | InChI=1S/C9H14N4O6S/c1-18-8(19-2)5-12-20(16,17)6-3-7(13(14)15)9(10)11-4-6/h3-4,8,12H,5H2,1-2H3,(H2,10,11) |
| InChIKey | WTIOMQSNIRDFJA-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|