C24H24BrN3O4 — CID 95060005
(13S)-8-(2-bromophenyl)-3,5,10,10-tetramethyl-13-(5-methylfuran-2-yl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione (PubChem CID 95060005) has the molecular formula C24H24BrN3O4 and a molecular weight of 498.38 g/mol. Its IUPAC name is (13S)-8-(2-bromophenyl)-3,5,10,10-tetramethyl-13-(5-methylfuran-2-yl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione.
| Compound Name | (13S)-8-(2-bromophenyl)-3,5,10,10-tetramethyl-13-(5-methylfuran-2-yl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
|---|---|
| PubChem CID | 95060005 |
| Molecular Formula | C24H24BrN3O4 |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | (13S)-8-(2-bromophenyl)-3,5,10,10-tetramethyl-13-(5-methylfuran-2-yl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
| SMILES | Cc1ccc([C@H]2OCC(C)(C)n3c(-c4ccccc4Br)c4c(=O)n(C)c(=O)n(C)c4c32)o1 |
| InChI | InChI=1S/C24H24BrN3O4/c1-13-10-11-16(32-13)21-20-19-17(22(29)27(5)23(30)26(19)4)18(14-8-6-7-9-15(14)25)28(20)24(2,3)12-31-21/h6-11,21H,12H2,1-5H3/t21-/m1/s1 |
| InChIKey | RCDYGNHCMFWUTB-OAQYLSRUSA-N |
| XLogP | 4.22 |
| TPSA | 71.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |