C18H21N3O3 — CID 950681
(3R)-3-[(3,5-dimethylpyrazol-1-yl)methyl]-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 950681) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is (3R)-3-[(3,5-dimethylpyrazol-1-yl)methyl]-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[(3,5-dimethylpyrazol-1-yl)methyl]-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 950681 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (3R)-3-[(3,5-dimethylpyrazol-1-yl)methyl]-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCOc1ccc(N2C(=O)C[C@H](Cn3nc(C)cc3C)C2=O)cc1 |
| InChI | InChI=1S/C18H21N3O3/c1-4-24-16-7-5-15(6-8-16)21-17(22)10-14(18(21)23)11-20-13(3)9-12(2)19-20/h5-9,14H,4,10-11H2,1-3H3/t14-/m1/s1 |
| InChIKey | CULQIWSZLRMHFG-CQSZACIVSA-N |
| XLogP | 2.48 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|