C18H19N3O5S2 — CID 95084946
(2S)-N-(furan-2-ylmethyl)-3-oxo-2-(pyrrolidine-1-carbonyl)-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 95084946) has the molecular formula C18H19N3O5S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is (2S)-N-(furan-2-ylmethyl)-3-oxo-2-(pyrrolidine-1-carbonyl)-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | (2S)-N-(furan-2-ylmethyl)-3-oxo-2-(pyrrolidine-1-carbonyl)-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 95084946 |
| Molecular Formula | C18H19N3O5S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | (2S)-N-(furan-2-ylmethyl)-3-oxo-2-(pyrrolidine-1-carbonyl)-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | O=C1Nc2cc(S(=O)(=O)NCc3ccco3)ccc2S[C@@H]1C(=O)N1CCCC1 |
| InChI | InChI=1S/C18H19N3O5S2/c22-17-16(18(23)21-7-1-2-8-21)27-15-6-5-13(10-14(15)20-17)28(24,25)19-11-12-4-3-9-26-12/h3-6,9-10,16,19H,1-2,7-8,11H2,(H,20,22)/t16-/m0/s1 |
| InChIKey | WNYPBGWQBBFHJJ-INIZCTEOSA-N |
| XLogP | 1.79 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|