C29H32ClN3O — CID 95113111
2-[(2R)-9-benzyl-4-(2,4-dimethylphenyl)-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]-4-chlorophenol (PubChem CID 95113111) has the molecular formula C29H32ClN3O and a molecular weight of 474.05 g/mol. Its IUPAC name is 2-[(2R)-9-benzyl-4-(2,4-dimethylphenyl)-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]-4-chlorophenol.
| Compound Name | 2-[(2R)-9-benzyl-4-(2,4-dimethylphenyl)-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]-4-chlorophenol |
|---|---|
| PubChem CID | 95113111 |
| Molecular Formula | C29H32ClN3O |
| Molecular Weight | 474.05 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 2-[(2R)-9-benzyl-4-(2,4-dimethylphenyl)-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]-4-chlorophenol |
| SMILES | Cc1ccc(C2=NC3(CCN(Cc4ccccc4)CC3)N[C@@H](c3cc(Cl)ccc3O)C2)c(C)c1 |
| InChI | InChI=1S/C29H32ClN3O/c1-20-8-10-24(21(2)16-20)26-18-27(25-17-23(30)9-11-28(25)34)32-29(31-26)12-14-33(15-13-29)19-22-6-4-3-5-7-22/h3-11,16-17,27,32,34H,12-15,18-19H2,1-2H3/t27-/m1/s1 |
| InChIKey | CNAGFGFCTVNPBO-HHHXNRCGSA-N |
| XLogP | 6.18 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.05 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|