C25H32ClN3O — CID 95113117
4-chloro-2-[(2R)-4-(2,5-dimethylphenyl)-9-propan-2-yl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol (PubChem CID 95113117) has the molecular formula C25H32ClN3O and a molecular weight of 426.00 g/mol. Its IUPAC name is 4-chloro-2-[(2R)-4-(2,5-dimethylphenyl)-9-propan-2-yl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol.
| Compound Name | 4-chloro-2-[(2R)-4-(2,5-dimethylphenyl)-9-propan-2-yl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol |
|---|---|
| PubChem CID | 95113117 |
| Molecular Formula | C25H32ClN3O |
| Molecular Weight | 426.00 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 4-chloro-2-[(2R)-4-(2,5-dimethylphenyl)-9-propan-2-yl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol |
| SMILES | Cc1ccc(C)c(C2=NC3(CCN(C(C)C)CC3)N[C@@H](c3cc(Cl)ccc3O)C2)c1 |
| InChI | InChI=1S/C25H32ClN3O/c1-16(2)29-11-9-25(10-12-29)27-22(20-13-17(3)5-6-18(20)4)15-23(28-25)21-14-19(26)7-8-24(21)30/h5-8,13-14,16,23,28,30H,9-12,15H2,1-4H3/t23-/m1/s1 |
| InChIKey | YIHVBCSEDXGCAK-HSZRJFAPSA-N |
| XLogP | 5.39 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.00 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|