C19H19N3O3S — CID 95138133
(13R)-13-(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)-5-thia-2,7,10-triazatricyclo[6.5.0.02,6]trideca-1(8),3,6-trien-11-one (PubChem CID 95138133) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is (13R)-13-(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)-5-thia-2,7,10-triazatricyclo[6.5.0.02,6]trideca-1(8),3,6-trien-11-one.
| Compound Name | (13R)-13-(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)-5-thia-2,7,10-triazatricyclo[6.5.0.02,6]trideca-1(8),3,6-trien-11-one |
|---|---|
| PubChem CID | 95138133 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (13R)-13-(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)-5-thia-2,7,10-triazatricyclo[6.5.0.02,6]trideca-1(8),3,6-trien-11-one |
| SMILES | C=CCc1cc([C@H]2CC(=O)NCc3nc4sccn4c32)cc(OC)c1O |
| InChI | InChI=1S/C19H19N3O3S/c1-3-4-11-7-12(8-15(25-2)18(11)24)13-9-16(23)20-10-14-17(13)22-5-6-26-19(22)21-14/h3,5-8,13,24H,1,4,9-10H2,2H3,(H,20,23)/t13-/m1/s1 |
| InChIKey | DGDWDJKFMIZKSG-CYBMUJFWSA-N |
| XLogP | 2.99 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|