C20H19N3O — CID 95130328
(14S)-14-(3-ethenylphenyl)-4-methyl-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one (PubChem CID 95130328) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is (14S)-14-(3-ethenylphenyl)-4-methyl-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one.
| Compound Name | (14S)-14-(3-ethenylphenyl)-4-methyl-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
|---|---|
| PubChem CID | 95130328 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (14S)-14-(3-ethenylphenyl)-4-methyl-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
| SMILES | C=Cc1cccc([C@@H]2CC(=O)NCc3nc4ccc(C)cn4c32)c1 |
| InChI | InChI=1S/C20H19N3O/c1-3-14-5-4-6-15(9-14)16-10-19(24)21-11-17-20(16)23-12-13(2)7-8-18(23)22-17/h3-9,12,16H,1,10-11H2,2H3,(H,21,24)/t16-/m0/s1 |
| InChIKey | ARCCJPLYQAIZSA-INIZCTEOSA-N |
| XLogP | 3.44 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |