C22H22N4O — CID 50961020
14-(2,3-dimethyl-1H-indol-7-yl)-4-methyl-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one (PubChem CID 50961020) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 14-(2,3-dimethyl-1H-indol-7-yl)-4-methyl-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one.
| Compound Name | 14-(2,3-dimethyl-1H-indol-7-yl)-4-methyl-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
|---|---|
| PubChem CID | 50961020 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 14-(2,3-dimethyl-1H-indol-7-yl)-4-methyl-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
| SMILES | Cc1ccc2nc3c(n2c1)C(c1cccc2c(C)c(C)[nH]c12)CC(=O)NC3 |
| InChI | InChI=1S/C22H22N4O/c1-12-7-8-19-25-18-10-23-20(27)9-17(22(18)26(19)11-12)16-6-4-5-15-13(2)14(3)24-21(15)16/h4-8,11,17,24H,9-10H2,1-3H3,(H,23,27) |
| InChIKey | DRWNFJVONRPJJF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|