C19H16ClN5O — CID 95124777
(14S)-14-(4-chloro-1-methylindazol-3-yl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one (PubChem CID 95124777) has the molecular formula C19H16ClN5O and a molecular weight of 365.82 g/mol. Its IUPAC name is (14S)-14-(4-chloro-1-methylindazol-3-yl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one.
| Compound Name | (14S)-14-(4-chloro-1-methylindazol-3-yl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
|---|---|
| PubChem CID | 95124777 |
| Molecular Formula | C19H16ClN5O |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | (14S)-14-(4-chloro-1-methylindazol-3-yl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
| SMILES | Cn1nc([C@H]2CC(=O)NCc3nc4ccccn4c32)c2c(Cl)cccc21 |
| InChI | InChI=1S/C19H16ClN5O/c1-24-14-6-4-5-12(20)17(14)18(23-24)11-9-16(26)21-10-13-19(11)25-8-3-2-7-15(25)22-13/h2-8,11H,9-10H2,1H3,(H,21,26)/t11-/m1/s1 |
| InChIKey | YAZRWHRQFLINEN-LLVKDONJSA-N |
| XLogP | 3.03 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |