C20H19N3O2S — CID 95147408
(14R)-14-[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one (PubChem CID 95147408) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is (14R)-14-[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one.
| Compound Name | (14R)-14-[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
|---|---|
| PubChem CID | 95147408 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | (14R)-14-[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
| SMILES | CC(C)(O)C#Cc1ccc([C@@H]2CC(=O)NCc3nc4ccccn4c32)s1 |
| InChI | InChI=1S/C20H19N3O2S/c1-20(2,25)9-8-13-6-7-16(26-13)14-11-18(24)21-12-15-19(14)23-10-4-3-5-17(23)22-15/h3-7,10,14,25H,11-12H2,1-2H3,(H,21,24)/t14-/m0/s1 |
| InChIKey | JGDQANCLOYSNNS-AWEZNQCLSA-N |
| XLogP | 2.67 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|