C21H19N5O — CID 50956795
14-[1-(3-methylphenyl)pyrazol-4-yl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one (PubChem CID 50956795) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is 14-[1-(3-methylphenyl)pyrazol-4-yl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one.
| Compound Name | 14-[1-(3-methylphenyl)pyrazol-4-yl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
|---|---|
| PubChem CID | 50956795 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 14-[1-(3-methylphenyl)pyrazol-4-yl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
| SMILES | Cc1cccc(-n2cc(C3CC(=O)NCc4nc5ccccn5c43)cn2)c1 |
| InChI | InChI=1S/C21H19N5O/c1-14-5-4-6-16(9-14)26-13-15(11-23-26)17-10-20(27)22-12-18-21(17)25-8-3-2-7-19(25)24-18/h2-9,11,13,17H,10,12H2,1H3,(H,22,27) |
| InChIKey | RZANAQVPOOSDCE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |