C19H18ClN3O3 — CID 95143649
(14R)-14-(5-chloro-2,3-dimethoxyphenyl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one (PubChem CID 95143649) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is (14R)-14-(5-chloro-2,3-dimethoxyphenyl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one.
| Compound Name | (14R)-14-(5-chloro-2,3-dimethoxyphenyl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
|---|---|
| PubChem CID | 95143649 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (14R)-14-(5-chloro-2,3-dimethoxyphenyl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
| SMILES | COc1cc(Cl)cc([C@H]2CC(=O)NCc3nc4ccccn4c32)c1OC |
| InChI | InChI=1S/C19H18ClN3O3/c1-25-15-8-11(20)7-13(19(15)26-2)12-9-17(24)21-10-14-18(12)23-6-4-3-5-16(23)22-14/h3-8,12H,9-10H2,1-2H3,(H,21,24)/t12-/m1/s1 |
| InChIKey | JVDSLLZTAQDIMO-GFCCVEGCSA-N |
| XLogP | 3.16 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |