C20H23N5O — CID 50957537
14-(5-cyclohexyl-1H-pyrazol-4-yl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one (PubChem CID 50957537) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 14-(5-cyclohexyl-1H-pyrazol-4-yl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one.
| Compound Name | 14-(5-cyclohexyl-1H-pyrazol-4-yl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
|---|---|
| PubChem CID | 50957537 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 14-(5-cyclohexyl-1H-pyrazol-4-yl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
| SMILES | O=C1CC(c2cn[nH]c2C2CCCCC2)c2c(nc3ccccn23)CN1 |
| InChI | InChI=1S/C20H23N5O/c26-18-10-14(15-11-22-24-19(15)13-6-2-1-3-7-13)20-16(12-21-18)23-17-8-4-5-9-25(17)20/h4-5,8-9,11,13-14H,1-3,6-7,10,12H2,(H,21,26)(H,22,24) |
| InChIKey | WCDNMUOZDQJEMK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |