C21H16ClN3O2 — CID 95147653
(14R)-14-[5-(3-chlorophenyl)furan-2-yl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one (PubChem CID 95147653) has the molecular formula C21H16ClN3O2 and a molecular weight of 377.83 g/mol. Its IUPAC name is (14R)-14-[5-(3-chlorophenyl)furan-2-yl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one.
| Compound Name | (14R)-14-[5-(3-chlorophenyl)furan-2-yl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
|---|---|
| PubChem CID | 95147653 |
| Molecular Formula | C21H16ClN3O2 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (14R)-14-[5-(3-chlorophenyl)furan-2-yl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
| SMILES | O=C1C[C@@H](c2ccc(-c3cccc(Cl)c3)o2)c2c(nc3ccccn23)CN1 |
| InChI | InChI=1S/C21H16ClN3O2/c22-14-5-3-4-13(10-14)17-7-8-18(27-17)15-11-20(26)23-12-16-21(15)25-9-2-1-6-19(25)24-16/h1-10,15H,11-12H2,(H,23,26)/t15-/m0/s1 |
| InChIKey | ASFOIUUUSVLPKX-HNNXBMFYSA-N |
| XLogP | 4.40 |
| TPSA | 59.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |