C16H12ClN5OS — CID 95132771
(14R)-14-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one (PubChem CID 95132771) has the molecular formula C16H12ClN5OS and a molecular weight of 357.83 g/mol. Its IUPAC name is (14R)-14-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one.
| Compound Name | (14R)-14-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
|---|---|
| PubChem CID | 95132771 |
| Molecular Formula | C16H12ClN5OS |
| Molecular Weight | 357.83 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | (14R)-14-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
| SMILES | O=C1C[C@@H](c2c(Cl)nc3sccn23)c2c(nc3ccccn23)CN1 |
| InChI | InChI=1S/C16H12ClN5OS/c17-15-14(22-5-6-24-16(22)20-15)9-7-12(23)18-8-10-13(9)21-4-2-1-3-11(21)19-10/h1-6,9H,7-8H2,(H,18,23)/t9-/m1/s1 |
| InChIKey | YFQWCTTVUQPXST-SECBINFHSA-N |
| XLogP | 2.85 |
| TPSA | 63.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.83 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |