C19H22N4OS — CID 95121544
(13S)-13-[4-(diethylamino)phenyl]-5-thia-2,7,10-triazatricyclo[6.5.0.02,6]trideca-1(8),3,6-trien-11-one (PubChem CID 95121544) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is (13S)-13-[4-(diethylamino)phenyl]-5-thia-2,7,10-triazatricyclo[6.5.0.02,6]trideca-1(8),3,6-trien-11-one.
| Compound Name | (13S)-13-[4-(diethylamino)phenyl]-5-thia-2,7,10-triazatricyclo[6.5.0.02,6]trideca-1(8),3,6-trien-11-one |
|---|---|
| PubChem CID | 95121544 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (13S)-13-[4-(diethylamino)phenyl]-5-thia-2,7,10-triazatricyclo[6.5.0.02,6]trideca-1(8),3,6-trien-11-one |
| SMILES | CCN(CC)c1ccc([C@@H]2CC(=O)NCc3nc4sccn4c32)cc1 |
| InChI | InChI=1S/C19H22N4OS/c1-3-22(4-2)14-7-5-13(6-8-14)15-11-17(24)20-12-16-18(15)23-9-10-25-19(23)21-16/h5-10,15H,3-4,11-12H2,1-2H3,(H,20,24)/t15-/m0/s1 |
| InChIKey | IDJJVDJJEHWEIC-HNNXBMFYSA-N |
| XLogP | 3.39 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|