C20H19N3O2 — CID 95129418
(14S)-14-[(E)-2-(2-methoxyphenyl)ethenyl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one (PubChem CID 95129418) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is (14S)-14-[(E)-2-(2-methoxyphenyl)ethenyl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one.
| Compound Name | (14S)-14-[(E)-2-(2-methoxyphenyl)ethenyl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
|---|---|
| PubChem CID | 95129418 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (14S)-14-[(E)-2-(2-methoxyphenyl)ethenyl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
| SMILES | COc1ccccc1/C=C/[C@@H]1CC(=O)NCc2nc3ccccn3c21 |
| InChI | InChI=1S/C20H19N3O2/c1-25-17-7-3-2-6-14(17)9-10-15-12-19(24)21-13-16-20(15)23-11-5-4-8-18(23)22-16/h2-11,15H,12-13H2,1H3,(H,21,24)/b10-9+/t15-/m1/s1 |
| InChIKey | YFJBZHJPWHTAIC-BOLDSZDNSA-N |
| XLogP | 3.16 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |