C22H25N3O2 — CID 95120230
(14S)-14-(4-butoxyphenyl)-4-methyl-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one (PubChem CID 95120230) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (14S)-14-(4-butoxyphenyl)-4-methyl-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one.
| Compound Name | (14S)-14-(4-butoxyphenyl)-4-methyl-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
|---|---|
| PubChem CID | 95120230 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (14S)-14-(4-butoxyphenyl)-4-methyl-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
| SMILES | CCCCOc1ccc([C@@H]2CC(=O)NCc3nc4ccc(C)cn4c32)cc1 |
| InChI | InChI=1S/C22H25N3O2/c1-3-4-11-27-17-8-6-16(7-9-17)18-12-21(26)23-13-19-22(18)25-14-15(2)5-10-20(25)24-19/h5-10,14,18H,3-4,11-13H2,1-2H3,(H,23,26)/t18-/m0/s1 |
| InChIKey | SVADIGUVOAUSOX-SFHVURJKSA-N |
| XLogP | 3.97 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|