C22H20N4O2 — CID 95134756
(14R)-14-(8-methoxyquinolin-2-yl)-4-methyl-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one (PubChem CID 95134756) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is (14R)-14-(8-methoxyquinolin-2-yl)-4-methyl-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one.
| Compound Name | (14R)-14-(8-methoxyquinolin-2-yl)-4-methyl-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
|---|---|
| PubChem CID | 95134756 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (14R)-14-(8-methoxyquinolin-2-yl)-4-methyl-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
| SMILES | COc1cccc2ccc([C@@H]3CC(=O)NCc4nc5ccc(C)cn5c43)nc12 |
| InChI | InChI=1S/C22H20N4O2/c1-13-6-9-19-24-17-11-23-20(27)10-15(22(17)26(19)12-13)16-8-7-14-4-3-5-18(28-2)21(14)25-16/h3-9,12,15H,10-11H2,1-2H3,(H,23,27)/t15-/m0/s1 |
| InChIKey | MHAWAOFSLRPZRW-HNNXBMFYSA-N |
| XLogP | 3.35 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |