C18H20N4OS2 — CID 95139756
(2S)-N-[(2,4-dimethylphenyl)methyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 95139756) has the molecular formula C18H20N4OS2 and a molecular weight of 372.52 g/mol. Its IUPAC name is (2S)-N-[(2,4-dimethylphenyl)methyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | (2S)-N-[(2,4-dimethylphenyl)methyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 95139756 |
| Molecular Formula | C18H20N4OS2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (2S)-N-[(2,4-dimethylphenyl)methyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | Cc1ccc(CNC(=O)[C@H](C)n2c(-c3cccs3)n[nH]c2=S)c(C)c1 |
| InChI | InChI=1S/C18H20N4OS2/c1-11-6-7-14(12(2)9-11)10-19-17(23)13(3)22-16(20-21-18(22)24)15-5-4-8-25-15/h4-9,13H,10H2,1-3H3,(H,19,23)(H,21,24)/t13-/m0/s1 |
| InChIKey | SEOIFCNOCLBOOY-ZDUSSCGKSA-N |
| XLogP | 4.16 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|