C13H13F3N2O4S — CID 95164261
1-[4-(trifluoromethylsulfonyl)benzoyl]-1,4-diazepan-5-one (PubChem CID 95164261) has the molecular formula C13H13F3N2O4S and a molecular weight of 350.32 g/mol. Its IUPAC name is 1-[4-(trifluoromethylsulfonyl)benzoyl]-1,4-diazepan-5-one.
| Compound Name | 1-[4-(trifluoromethylsulfonyl)benzoyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 95164261 |
| Molecular Formula | C13H13F3N2O4S |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 1-[4-(trifluoromethylsulfonyl)benzoyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)c2ccc(S(=O)(=O)C(F)(F)F)cc2)CCN1 |
| InChI | InChI=1S/C13H13F3N2O4S/c14-13(15,16)23(21,22)10-3-1-9(2-4-10)12(20)18-7-5-11(19)17-6-8-18/h1-4H,5-8H2,(H,17,19) |
| InChIKey | XLSNUYBJYNQDSF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |