C18H24N4OS — CID 95179100
(E)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-(2,4,5-trimethylphenyl)prop-2-enamide (PubChem CID 95179100) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is (E)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-(2,4,5-trimethylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-(2,4,5-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 95179100 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (E)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-(2,4,5-trimethylphenyl)prop-2-enamide |
| SMILES | CCn1c(CCNC(=O)/C=C/c2cc(C)c(C)cc2C)n[nH]c1=S |
| InChI | InChI=1S/C18H24N4OS/c1-5-22-16(20-21-18(22)24)8-9-19-17(23)7-6-15-11-13(3)12(2)10-14(15)4/h6-7,10-11H,5,8-9H2,1-4H3,(H,19,23)(H,21,24)/b7-6+ |
| InChIKey | XMBADFAGMSLCEM-VOTSOKGWSA-N |
| XLogP | 3.26 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|