C14H19N9 — CID 95215759
[1-[[(3R)-1-(7H-purin-6-yl)piperidin-3-yl]methyl]triazol-4-yl]methanamine (PubChem CID 95215759) has the molecular formula C14H19N9 and a molecular weight of 313.37 g/mol. Its IUPAC name is [1-[[(3R)-1-(7H-purin-6-yl)piperidin-3-yl]methyl]triazol-4-yl]methanamine.
| Compound Name | [1-[[(3R)-1-(7H-purin-6-yl)piperidin-3-yl]methyl]triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 95215759 |
| Molecular Formula | C14H19N9 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | [1-[[(3R)-1-(7H-purin-6-yl)piperidin-3-yl]methyl]triazol-4-yl]methanamine |
| SMILES | NCc1cn(C[C@@H]2CCCN(c3ncnc4nc[nH]c34)C2)nn1 |
| InChI | InChI=1S/C14H19N9/c15-4-11-7-23(21-20-11)6-10-2-1-3-22(5-10)14-12-13(17-8-16-12)18-9-19-14/h7-10H,1-6,15H2,(H,16,17,18,19)/t10-/m1/s1 |
| InChIKey | QHRTUDUPFHGPGH-SNVBAGLBSA-N |
| XLogP | 0.32 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |