C18H25N9 — CID 45196726
6-[3-[[4-(pyrrolidin-1-ylmethyl)triazol-1-yl]methyl]piperidin-1-yl]-7H-purine (PubChem CID 45196726) has the molecular formula C18H25N9 and a molecular weight of 367.46 g/mol. Its IUPAC name is 6-[3-[[4-(pyrrolidin-1-ylmethyl)triazol-1-yl]methyl]piperidin-1-yl]-7H-purine.
| Compound Name | 6-[3-[[4-(pyrrolidin-1-ylmethyl)triazol-1-yl]methyl]piperidin-1-yl]-7H-purine |
|---|---|
| PubChem CID | 45196726 |
| Molecular Formula | C18H25N9 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | 6-[3-[[4-(pyrrolidin-1-ylmethyl)triazol-1-yl]methyl]piperidin-1-yl]-7H-purine |
| SMILES | c1nc(N2CCCC(Cn3cc(CN4CCCC4)nn3)C2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C18H25N9/c1-2-6-25(5-1)10-15-11-27(24-23-15)9-14-4-3-7-26(8-14)18-16-17(20-12-19-16)21-13-22-18/h11-14H,1-10H2,(H,19,20,21,22) |
| InChIKey | OWHPEGJLKSGAMH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |