C22H24O10S2 — CID 95239931
[(2R)-2-[(2S)-3,4-dimethoxy-5-oxo-2H-furan-2-yl]-2-(4-methylphenyl)sulfonyloxyethyl] 4-methylbenzenesulfonate (PubChem CID 95239931) has the molecular formula C22H24O10S2 and a molecular weight of 512.56 g/mol. Its IUPAC name is [(2R)-2-[(2S)-3,4-dimethoxy-5-oxo-2H-furan-2-yl]-2-(4-methylphenyl)sulfonyloxyethyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-2-[(2S)-3,4-dimethoxy-5-oxo-2H-furan-2-yl]-2-(4-methylphenyl)sulfonyloxyethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 95239931 |
| Molecular Formula | C22H24O10S2 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | [(2R)-2-[(2S)-3,4-dimethoxy-5-oxo-2H-furan-2-yl]-2-(4-methylphenyl)sulfonyloxyethyl] 4-methylbenzenesulfonate |
| SMILES | COC1=C(OC)[C@H]([C@@H](COS(=O)(=O)c2ccc(C)cc2)OS(=O)(=O)c2ccc(C)cc2)OC1=O |
| InChI | InChI=1S/C22H24O10S2/c1-14-5-9-16(10-6-14)33(24,25)30-13-18(19-20(28-3)21(29-4)22(23)31-19)32-34(26,27)17-11-7-15(2)8-12-17/h5-12,18-19H,13H2,1-4H3/t18-,19+/m1/s1 |
| InChIKey | SZCDDOBRSONPHY-MOPGFXCFSA-N |
| XLogP | 2.21 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|