C9H11NO2 — CID 95241574
(1S,2R)-2-amino-2,3-dihydro-1H-indene-1,4-diol (PubChem CID 95241574) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is (1S,2R)-2-amino-2,3-dihydro-1H-indene-1,4-diol.
| Compound Name | (1S,2R)-2-amino-2,3-dihydro-1H-indene-1,4-diol |
|---|---|
| PubChem CID | 95241574 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (1S,2R)-2-amino-2,3-dihydro-1H-indene-1,4-diol |
| SMILES | N[C@@H]1Cc2c(O)cccc2[C@@H]1O |
| InChI | InChI=1S/C9H11NO2/c10-7-4-6-5(9(7)12)2-1-3-8(6)11/h1-3,7,9,11-12H,4,10H2/t7-,9+/m1/s1 |
| InChIKey | NCZWZYJTZSWFAY-APPZFPTMSA-N |
| XLogP | 0.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |