C9H11NO — CID 10582937
(1R,2R,3R)-2-amino-3-deuterio-2,3-dihydro-1H-inden-1-ol (PubChem CID 10582937) has the molecular formula C9H11NO and a molecular weight of 150.20 g/mol. Its IUPAC name is (1R,2R,3R)-2-amino-3-deuterio-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1R,2R,3R)-2-amino-3-deuterio-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 10582937 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | (1R,2R,3R)-2-amino-3-deuterio-2,3-dihydro-1H-inden-1-ol |
| SMILES | [2H][C@@H]1c2ccccc2[C@@H](O)[C@@H]1N |
| InChI | InChI=1S/C9H11NO/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8-9,11H,5,10H2/t8-,9-/m1/s1/i5D/t5-,8-,9- |
| InChIKey | HRWCWYGWEVVDLT-RBGDDHRTSA-N |
| XLogP | 0.60 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |