C16H15ClF2N2O2 — CID 95249859
methyl (2S)-2-[(2-chloro-3-pyridinyl)methylamino]-2-(2,5-difluorophenyl)propanoate (PubChem CID 95249859) has the molecular formula C16H15ClF2N2O2 and a molecular weight of 340.76 g/mol. Its IUPAC name is methyl (2S)-2-[(2-chloro-3-pyridinyl)methylamino]-2-(2,5-difluorophenyl)propanoate.
| Compound Name | methyl (2S)-2-[(2-chloro-3-pyridinyl)methylamino]-2-(2,5-difluorophenyl)propanoate |
|---|---|
| PubChem CID | 95249859 |
| Molecular Formula | C16H15ClF2N2O2 |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | methyl (2S)-2-[(2-chloro-3-pyridinyl)methylamino]-2-(2,5-difluorophenyl)propanoate |
| SMILES | COC(=O)[C@@](C)(NCc1cccnc1Cl)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H15ClF2N2O2/c1-16(15(22)23-2,12-8-11(18)5-6-13(12)19)21-9-10-4-3-7-20-14(10)17/h3-8,21H,9H2,1-2H3/t16-/m0/s1 |
| InChIKey | IBLLJVLOUCNUBW-INIZCTEOSA-N |
| XLogP | 3.19 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|