C11H8N4O3S — CID 95289569
(2R)-2-(5-nitrothiophen-3-yl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 95289569) has the molecular formula C11H8N4O3S and a molecular weight of 276.28 g/mol. Its IUPAC name is (2R)-2-(5-nitrothiophen-3-yl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | (2R)-2-(5-nitrothiophen-3-yl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 95289569 |
| Molecular Formula | C11H8N4O3S |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | (2R)-2-(5-nitrothiophen-3-yl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=C1N[C@H](c2csc([N+](=O)[O-])c2)Nc2ncccc21 |
| InChI | InChI=1S/C11H8N4O3S/c16-11-7-2-1-3-12-10(7)13-9(14-11)6-4-8(15(17)18)19-5-6/h1-5,9H,(H,12,13)(H,14,16)/t9-/m1/s1 |
| InChIKey | OYJIVGZMPHAETG-SECBINFHSA-N |
| XLogP | 1.91 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|