C21H24N4O — CID 95305414
(6S)-N-(2-benzhydryloxyethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95305414) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is (6S)-N-(2-benzhydryloxyethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6S)-N-(2-benzhydryloxyethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95305414 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (6S)-N-(2-benzhydryloxyethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | c1ccc(C(OCCN[C@H]2CCc3ncnn3C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N4O/c1-3-7-17(8-4-1)21(18-9-5-2-6-10-18)26-14-13-22-19-11-12-20-23-16-24-25(20)15-19/h1-10,16,19,21-22H,11-15H2/t19-/m0/s1 |
| InChIKey | OTZYOFLFNBIMMR-IBGZPJMESA-N |
| XLogP | 2.99 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|