C15H20N4O2S — CID 95340760
(6R)-N-[3-(benzenesulfonyl)propyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95340760) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is (6R)-N-[3-(benzenesulfonyl)propyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6R)-N-[3-(benzenesulfonyl)propyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95340760 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (6R)-N-[3-(benzenesulfonyl)propyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | O=S(=O)(CCCN[C@@H]1CCc2ncnn2C1)c1ccccc1 |
| InChI | InChI=1S/C15H20N4O2S/c20-22(21,14-5-2-1-3-6-14)10-4-9-16-13-7-8-15-17-12-18-19(15)11-13/h1-3,5-6,12-13,16H,4,7-11H2/t13-/m1/s1 |
| InChIKey | DQBYJVDSBGRBGW-CYBMUJFWSA-N |
| XLogP | 1.05 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|