C15H20N2O3 — CID 95308356
(2R)-N,N-dimethyl-2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanamide (PubChem CID 95308356) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanamide.
| Compound Name | (2R)-N,N-dimethyl-2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 95308356 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (2R)-N,N-dimethyl-2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanamide |
| SMILES | CN(C)C(=O)[C@@H](Cc1ccccc1)N1CCCOC1=O |
| InChI | InChI=1S/C15H20N2O3/c1-16(2)14(18)13(11-12-7-4-3-5-8-12)17-9-6-10-20-15(17)19/h3-5,7-8,13H,6,9-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | VJYIHOYXCVHKLH-CYBMUJFWSA-N |
| XLogP | 1.53 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |