C21H22N4O3S — CID 95343299
3-[(4aS,8aR)-1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl]-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 95343299) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is 3-[(4aS,8aR)-1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl]-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-[(4aS,8aR)-1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl]-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 95343299 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 3-[(4aS,8aR)-1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl]-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CCc1nc(NC(=O)c2cccc(N3NC(=O)[C@H]4CC=CC[C@H]4C3=O)c2)sc1C |
| InChI | InChI=1S/C21H22N4O3S/c1-3-17-12(2)29-21(22-17)23-18(26)13-7-6-8-14(11-13)25-20(28)16-10-5-4-9-15(16)19(27)24-25/h4-8,11,15-16H,3,9-10H2,1-2H3,(H,24,27)(H,22,23,26)/t15-,16+/m0/s1 |
| InChIKey | VLYSEOGMHVTSKB-JKSUJKDBSA-N |
| XLogP | 3.23 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|