C20H23N3O3 — CID 52520790
(4aR,8aS)-3-[3-(piperidine-1-carbonyl)phenyl]-4a,5,8,8a-tetrahydro-2H-phthalazine-1,4-dione (PubChem CID 52520790) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is (4aR,8aS)-3-[3-(piperidine-1-carbonyl)phenyl]-4a,5,8,8a-tetrahydro-2H-phthalazine-1,4-dione.
| Compound Name | (4aR,8aS)-3-[3-(piperidine-1-carbonyl)phenyl]-4a,5,8,8a-tetrahydro-2H-phthalazine-1,4-dione |
|---|---|
| PubChem CID | 52520790 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (4aR,8aS)-3-[3-(piperidine-1-carbonyl)phenyl]-4a,5,8,8a-tetrahydro-2H-phthalazine-1,4-dione |
| SMILES | O=C1NN(c2cccc(C(=O)N3CCCCC3)c2)C(=O)[C@@H]2CC=CC[C@H]12 |
| InChI | InChI=1S/C20H23N3O3/c24-18-16-9-2-3-10-17(16)20(26)23(21-18)15-8-6-7-14(13-15)19(25)22-11-4-1-5-12-22/h2-3,6-8,13,16-17H,1,4-5,9-12H2,(H,21,24)/t16-,17+/m0/s1 |
| InChIKey | AZBDKFPQAZPSSQ-DLBZAZTESA-N |
| XLogP | 2.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|